Temperature effects on the stereospecificity of nucleophilic fluorination: Formation of trans-[18F]4-fluoro-l-proline during the synthesis of cis-[18F]4-fluoro-l-proline
Babak Behnam Azad, Rezwan Ashique, N. Renée Labiris, Raman Chirakal
Dive into the research topics of 'Temperature effects on the stereospecificity of nucleophilic fluorination: Formation of trans-[18F]4-fluoro-l-proline during the synthesis of cis-[18F]4-fluoro-l-proline'. Together they form a unique fingerprint.